Chemistry MJ 12/2015 questions and expected gt for physics P12

Expected gt of physics paper 12/2015?


  • Total voters
    26
  • Poll closed .
Messages
3,355
Reaction score
20,175
Points
523
Okay 24hrs have passed.... So here are the qstns i have compiled.... You can all discuss :)

Btw how was phys paper 12/2015.... Expected gt?

Dont remember the sequence correctly: some of the answers mentioned are confirmed correct...

Q1 Which contains the same Number of electrons and neutron in 4 elements/ions/isotopes?(B)

Q2 An egg has mass of 50g. 5% is CaCO3. How much egg shells
required to neutralise 50cm^3 of 2.00mol/dm^3 of ethanoic acid?

Q3 Which compound or element has simple molecule lattice?(D)

Q4 PV=nRT. 103KPa of methane with volume of 5.37*10^-3(dont remember exact volume) at 60 degree temperature. Mass of methane?(D)

Q5 Purification of copper... What is correct order of anode cathode and change in solution?(A)

Q6 Which statement related to boltzman distribution curve is correct?(B)

Q7 Which statement related to silver ions and copper of glasses(shades) is correct?(A)

Q8 Which two area have reactants which form sodium chlorate? abestos diaphragm PQRS(P and S(Cl2 and NaOH))

Q9 Cholrate ions balancing?(C)

Q10 Which refractory material is X? X is heated to release CO2 and white solid. Y is used as refractory material.(C)

Q11 Which statement related to PH3 with H+ bonding is correct?(A)

Q12 Which statement related to Ammonium ion is correct?(D)

Q13 What were the temperature and pressure for N2O4 in equilibrium?(B)

Q14 Partial pressure Kp of HI?(A)

Q15 Ionization and electronegativity graph?(A)

Q16 What is the structure formed when an excess of HBr is used?(it was the one with both OH groups replaced with Br and the top of double bond had Br attached to it... Its either C or D)

Q17 Which will not make propene?(B)

Q18 Huge structure... When strong acid is used, which is the smallest structure?(B)

Q19 Which structure is optically active with six carbon atoms?(B, 2-methylpentan-3-ol)

Q20 Structure containing 3carboxylic acid and 1 OH. How much volume of hydrogen formed?(Dont remember this question exactly)(C)

Q21 3g of metallic nitrate is decomposed releasing 1.53g of gases. What is the structure?(D)

Q22 What is same in 31P and 37Cl?(D)

Q23 What are the interactions
present Al2Cl6 which sublimes at idk what temperature?

Q24 What is true about exothermic reactions?

Q25 Which of the three are redox reactions?(B)

Q26 What is true about the lactic acid?(D)

Q27 What is correct for halogeno hydrocarbon?(A)

Q28 Which if these 3 structures lie in same plane?

Q29 What is formed when NaBH4 is used on CH3-C-HC(=CH2)(OH)-CH2-CHO(B)

Q30 What is the correct equation for the formation of Hexane structure?(the enthalpy qstn where correct equation was to be selected)(C)

Q31 Which statement of monopotassiumcitrate are correct?(dibasic, no chiral and it can react with NaHCO3)(A)

Q32 Dihalogenoalkane converted to Q and to dicarboxylic acid.
What reagents are involved in Step 1 and 2?(D)

Q33 A mass of propan-2-ol was given to calculate the mass of propanone which yielded 74% mass.(A)

Q34 How may chiral carbons were present in the structure?(C, it was 7. Dont accurately which option waa 7)

If anyone of you remember anyother, plz tell me-i'll update my comment.

kitkat <3 :P Starlight97 Ahmed Aqdam asadalam KatnissEver Abdul Hanan hamzashariq
afrolina
 
Last edited:
Messages
616
Reaction score
2,961
Points
253
Okay 24hrs have passed.... So here are the qstns i have compiled.... You can all discuss :)

Btw how was phys paper 12/2015.... Expected gt?

Dont remember the sequence correctly:

Q1 Which contains the same Number of electrons and neutron in 4 elements/ions/isotopes?

Q2 An egg has mass of 50g. 5% is CaCO3. How much egg shells
required to neutralise 50cm^3 of 2.00mol/dm^3 of ethanoic acid?

Q3 Which compound or element has simple molecule lattice?

Q4 PV=nRT. 103KPa of methane with volume of 5.37*10^-3(dont remember exact volume) at 60 degree temperature. Mass of methane?

Q5 Purification of copper... What is correct order of anode cathode and change in solution?

Q6 Which statement related to boltzman distribution curve is correct?

Q7 Which statement related to silver ions and copper of glasses(shades) is correct?

Q8 Which two area have reactants which form sodium chlorate? abestos diaphragm PQRS

Q9 Cholrate ions balancing?

Q10 Which refractory material is X? X is heated to release CO2 and white solid. Y is used as refractory material.

Q11 Which statement related to PH3 with H+ bonding is correct?

Q12 Which statement related to Ammonium ion is correct?

Q13 What were the temperature and pressure for N2O4 in equilibrium?

Q14 Partial pressure Kp of HI?

Q15 Ionization and electronegativity graph?

Q16 What is the structure formed when an excess of HBr is used?

Q17 Which will not make propene?

Q18 Huge structure... When strong acid is used, which is the smallest structure?

Q19 Which structure is optically active with six carbon atoms?

Q20 Structure containing 3carboxylic acid and 1 OH. How much volume of hydrogen formed?(Dont remember this question exactly)

Q21 3g of metallic nitrate is decomposed releasing 1.53g of gases. What is the structure?

Q22 What is same in 31P and 37Cl?

Q23 What are the interactions
present Al2Cl6 which sublimes at idk what temperature?

Q24 What is true about exothermic reactions?

Q25 Which of the three are redox reactions?

Q26 What is true about the lactic acid?

Q27 What is correct for halogeno hydrocarbon?

Q28 Which if these 3 structures lie in same plane?

Q29 What is formed when NaBH4 is used on CH3-C-HC(=CH2)(OH)-CH2-CHO

Q30 What is the correct equation for the formation of Hexane structure?(the enthalpy qstn where correct equation was to be selected)

Q31 Which statement of monopotassiumcitrate are correct?(dibasic, no chiral and it can react with NaHCO3)

Q32 Dihalogenoalkane converted to Q and to dicarboxylic acid.
What reagents are involved in Step 1 and 2?

Q33 A mass of propan-2-ol was given to calculate the mass of propanone which yielded 74% mass.

Q34 How may chiral carbons were present in the structure?

If anyone of you remember anyother, plz tell me-i'll update my comment.

kitkat <3 :P Starlight97 Ahmed Aqdam asadalam KatnissEver Abdul Hanan hamzashariq
afrolina
Didn't get the alert :/
 
Messages
1,229
Reaction score
740
Points
123
for Q6 i choose B... what about u people? and Q28 I wrote A( all of them) thou I'm not sure :/ Q9 i choose the option with 3,5 etc
Q7 i wrote B.. because Cu was getting oxidised:s
Q12 i choose D.. ' all bond pairs are of same length'

:p
 
Messages
3,355
Reaction score
20,175
Points
523
for Q6 i choose B... what about u people? and Q28 I wrote A( all of them) thou I'm not sure :/ Q9 i choose the option with 3,5 etc
Q7 i wrote B.. because Cu was getting oxidised:s
Q12 i choose D.. ' all bond pairs are of same length'

:p
Your Q6 is correct
Idk whats the correctans for 28, its either A or B
Ur Q9 is also correct
Q7 u shud have marked A because in B he said Cu is getting oxidised in reaction 2 but actually it was reducing in reaction 2(Cu was acting as homogeneous catalyst)
Q12 is correct
14 was A...
 
Messages
1,229
Reaction score
740
Points
123
Your Q6 is correct
Idk whats the correctans for 28, its either A or B
Ur Q9 is also correct
Q7 u shud have marked A because in B he said Cu is getting oxidised in reaction 2 but actually it was reducing in reaction 2(Cu was acting as homogeneous catalyst)
Q12 is correct
14 was A...
Q7; A was that both Cu + & Cu2+ were acting as catalyst.. which seemed not to be true because one of these ions was not regenerating..
Furthermore in reaction 2, Cu+ were oxidised to Cu2+ ions so they were acting as a reducing agent and were getting oxidised.. So B seems correct to me :S
+ this was a repeated question as far as I remember
 
Messages
1,229
Reaction score
740
Points
123
What was the answer for Question 30 (the one with a really large structure given) ..in which we had to search for the largest Mr product when it was reacted with aq NaOh? :/

and Q2?
 
Last edited:
Messages
3,355
Reaction score
20,175
Points
523
Q7; A was that both Cu + & Cu2+ were acting as catalyst.. which seemed not to be true because one of these ions was not regenerating..
Furthermore in reaction 2, Cu+ were oxidised to Cu2+ ions so they were acting as a reducing agent and were getting oxidised.. So B seems correct to me :S
+ this was a repeated question as far as I remember
And repeat has the ans A... Plus maybe it was written reaction 3.... I did that quickly...
And Cu+ was regenerated in reaction 3... Cu+ to Cu2+ in reaction2 and back to Cu+ in reaction 3... I remember i saw Cu+ in reaction 3 also on product side...
Oho u didnt get the statement correct... It actually wanted to say that Cu ions were acting as catalyst.
Like the question came of reaction between SO2 and NO2
SO2+NO2------> SO3+NO
NO+1/2O2----->NO2
Both NO2 and NO are acting as catalyst because NO2 is regenerated from NO.
 
Last edited:
Messages
1,229
Reaction score
740
Points
123
And repeat has the ans A... Plus maybe it was written reaction 3.... I did that quickly...
And Cu+ was regenerated in reaction 3... Cu+ to Cu2+ in reaction2 and back to Cu+ in reaction 3... I remember i saw Cu+ in reaction 3 also on product side
then may be Cu2+ was not regenerating!
do u remember the year :D
 
Messages
167
Reaction score
45
Points
28
W
Okay 24hrs have passed.... So here are the qstns i have compiled.... You can all discuss :)

Btw how was phys paper 12/2015.... Expected gt?

Dont remember the sequence correctly: some of the answers mentioned are confirmed correct...

Q1 Which contains the same Number of electrons and neutron in 4 elements/ions/isotopes?(B)

Q2 An egg has mass of 50g. 5% is CaCO3. How much egg shells
required to neutralise 50cm^3 of 2.00mol/dm^3 of ethanoic acid?

Q3 Which compound or element has simple molecule lattice?(D)

Q4 PV=nRT. 103KPa of methane with volume of 5.37*10^-3(dont remember exact volume) at 60 degree temperature. Mass of methane?(D)

Q5 Purification of copper... What is correct order of anode cathode and change in solution?(A)

Q6 Which statement related to boltzman distribution curve is correct?(B)

Q7 Which statement related to silver ions and copper of glasses(shades) is correct?(A)

Q8 Which two area have reactants which form sodium chlorate? abestos diaphragm PQRS(P and S(Cl2 and NaOH))

Q9 Cholrate ions balancing?(C)

Q10 Which refractory material is X? X is heated to release CO2 and white solid. Y is used as refractory material.(C)

Q11 Which statement related to PH3 with H+ bonding is correct?(A)

Q12 Which statement related to Ammonium ion is correct?(D)

Q13 What were the temperature and pressure for N2O4 in equilibrium?(B)

Q14 Partial pressure Kp of HI?(A)

Q15 Ionization and electronegativity graph?(A)

Q16 What is the structure formed when an excess of HBr is used?(it was the one with both OH groups replaced with Br and the top of double bond had Br attached to it... Its either C or D)

Q17 Which will not make propene?(B)

Q18 Huge structure... When strong acid is used, which is the smallest structure?(B)

Q19 Which structure is optically active with six carbon atoms?(B, 2-methylpentan-3-ol)

Q20 Structure containing 3carboxylic acid and 1 OH. How much volume of hydrogen formed?(Dont remember this question exactly)(C)

Q21 3g of metallic nitrate is decomposed releasing 1.53g of gases. What is the structure?(D)

Q22 What is same in 31P and 37Cl?(D)

Q23 What are the interactions
present Al2Cl6 which sublimes at idk what temperature?

Q24 What is true about exothermic reactions?

Q25 Which of the three are redox reactions?(B)

Q26 What is true about the lactic acid?(D)

Q27 What is correct for halogeno hydrocarbon?(A)

Q28 Which if these 3 structures lie in same plane?

Q29 What is formed when NaBH4 is used on CH3-C-HC(=CH2)(OH)-CH2-CHO(B)

Q30 What is the correct equation for the formation of Hexane structure?(the enthalpy qstn where correct equation was to be selected)(C)

Q31 Which statement of monopotassiumcitrate are correct?(dibasic, no chiral and it can react with NaHCO3)(A)

Q32 Dihalogenoalkane converted to Q and to dicarboxylic acid.
What reagents are involved in Step 1 and 2?(D)

Q33 A mass of propan-2-ol was given to calculate the mass of propanone which yielded 74% mass.(A)

Q34 How may chiral carbons were present in the structure?(C, it was 7. Dont accurately which option waa 7)

If anyone of you remember anyother, plz tell me-i'll update my comment.

kitkat <3 :P Starlight97 Ahmed Aqdam asadalam KatnissEver Abdul Hanan hamzashariq
afrolina
What was the answer to eggshell ques? Q2 in paper
 
Messages
107
Reaction score
83
Points
38
Q3 option C was MgO and question was included that Y is MgO as far as I could remember and the question was what was the compound Y that liberated gas -(word isn't exactly the question )
 
Messages
3,355
Reaction score
20,175
Points
523
Q3 option C was MgO and question was included that Y is MgO as far as I could remember and the question was what was the compound Y that liberated gas -(word isn't exactly the question )
D was MgO
C was MgCO3
 
Top