Chemistry: Post your doubts here!

[The Sarcastic Retard]

So it is not (OH)2(H2O)4 ?

It is that only...

 

[The Sarcastic Retard]

So it is not (OH)2(H2O)4 ?

It is that only...

 

[Lola_sweet]

1) explain, in terms of rates of the forward and reverse reactions, what is meant by a reversible reaction?
2) calculate the quantities present at equilibrium, given appropriate data (such calculations will not require the solving of quadratic equations)

anyone have notes for these points from the syllabus?

 

[qwertypoiu]

1) explain, in terms of rates of the forward and reverse reactions, what is meant by a reversible reaction?
2) calculate the quantities present at equilibrium, given appropriate data (such calculations will not require the solving of quadratic equations)

anyone have notes for these points from the syllabus?

You're looking for 7.1a and 7.1f

Hope the links are helpful

 

[qwertypoiu]

So it is not (OH)2(H2O)4 ?

Both refer to the same thing.

Ni(OH)2 is just a short form of what is technically more correct, Ni(H2O)4(OH)2

 

[qwertypoiu]

Can anyone draw structure of Fe(EDTA)
qwertypoiu

Sorry I've never heard of that

 

[holoholo]

(iii) why is the mechanism nucleophilic ? isn't it electrophilic with respect to the organic compound ?

 

[Mathemagical]

View attachment 59632

(iii) why is the mechanism nucleophilic ? isn't it electrophilic with respect to the organic compound ?

NH3 is the nucleophile because it has a lone pair which "attacks" the electron deficient centre.

 

[holoholo]

NH3 is the nucleophile because it has a lone pair which "attacks" the electron deficient centre.

How about the chlorine that replaces the hydrogen in the first step. what mechanism is that ?

 

[Mathemagical]

How about the chlorine that replaces the hydrogen in the first step. what mechanism is that ?

That is free radical substitution.

 

[holoholo]

That is free radical substitution.

Can you help me in this ? in the mark scheme, it's written the concentration of the complex is 0.1. Shouldn't it be 0.1 minus the concentration of c(i) ?

 

[holoholo]

Can someone explain this ?

 

[Eugene99]

26th one. How comes it's C?

 

[The Sarcastic Retard]

View attachment 59635
Can you help me in this ? in the mark scheme, it's written the concentration of the complex is 0.1. Shouldn't it be 0.1 minus the concentration of c(i) ?

what is c(i)

 

[Saad the Paki]

26th one. How comes it's C?View attachment 59637

What we require here is a tertiary alcohol with a chiral carbon. You can check by drawing that 5 and 6 carbons will not give you a chiral carbon along with a tertiary alcohol. So 7 is the minimum number. The structure will be:
CH3CH2C(OH)(CH3)CH2CH2CH3

 

[holoholo]

what is c(i)

7.1 x 10^-7

 

[Mathemagical]

26th one. How comes it's C?View attachment 59637

1. It has to be a tertiary alcohol, as it cannot be oxidised.
2. It is chiral, so it has 4 different groups attached to the main C atom.

 

[Sirius48]

Can anyone draw structure of Fe(EDTA)
qwertypoiu

Here you go. It would be a really crowded structure in a space fill model.

 

[qwertypoiu]

View attachment 59636

Can someone explain this ?

Chemistry: Post your doubts here!
I answered this previously on that link. See if it helps

 

[qwertypoiu]

Here you go. It would be a really crowded structure in a space fill model.

Are we required to know this? I've never heard of EDTA :/